C27H42O — CID 91844474
(1S)-3-[(E)-2-[(1R,3aR,7aR)-7a-methyl-1-[(2S)-6-methylhept-5-en-2-yl]-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-4-methylcyclohex-3-en-1-ol (PubChem CID 91844474) has the molecular formula C27H42O and a molecular weight of 382.63 g/mol. Its IUPAC name is (1S)-3-[(E)-2-[(1R,3aR,7aR)-7a-methyl-1-[(2S)-6-methylhept-5-en-2-yl]-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-4-methylcyclohex-3-en-1-ol.
| Compound Name | (1S)-3-[(E)-2-[(1R,3aR,7aR)-7a-methyl-1-[(2S)-6-methylhept-5-en-2-yl]-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-4-methylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 91844474 |
| Molecular Formula | C27H42O |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 382.32 |
| IUPAC Name | (1S)-3-[(E)-2-[(1R,3aR,7aR)-7a-methyl-1-[(2S)-6-methylhept-5-en-2-yl]-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-4-methylcyclohex-3-en-1-ol |
| SMILES | CC(C)=CCC[C@H](C)[C@H]1CC[C@H]2C(/C=C/C3=C(C)CC[C@H](O)C3)=CCC[C@]12C |
| InChI | InChI=1S/C27H42O/c1-19(2)8-6-9-21(4)25-15-16-26-22(10-7-17-27(25,26)5)12-13-23-18-24(28)14-11-20(23)3/h8,10,12-13,21,24-26,28H,6-7,9,11,14-18H2,1-5H3/b13-12+/t21-,24-,25+,26-,27+/m0/s1 |
| InChIKey | NBMBTEIQSCVAHQ-RXMRUOPJSA-N |
| XLogP | 7.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|