About 1,1-dibutoxy-2-methylpentane-2,4-diol
1,1-dibutoxy-2-methylpentane-2,4-diol (PubChem CID 91844562) has the molecular formula C14H30O4
and a molecular weight of 262.39 g/mol. Its IUPAC name is 1,1-dibutoxy-2-methylpentane-2,4-diol.
Molecular Properties
| Compound Name | 1,1-dibutoxy-2-methylpentane-2,4-diol |
| PubChem CID | 91844562 |
| Molecular Formula | C14H30O4 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | 1,1-dibutoxy-2-methylpentane-2,4-diol |
| SMILES | CCCCOC(OCCCC)C(C)(O)CC(C)O |
| InChI | InChI=1S/C14H30O4/c1-5-7-9-17-13(18-10-8-6-2)14(4,16)11-12(3)15/h12-13,15-16H,5-11H2,1-4H3 |
| InChIKey | WQRDRXRSKWWVEW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dibutoxy-2-methylpentane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dibutoxy-2-methylpentane-2,4-diol?
The IUPAC name of 1,1-dibutoxy-2-methylpentane-2,4-diol (CID 91844562) is 1,1-dibutoxy-2-methylpentane-2,4-diol.
What is the SMILES notation for 1,1-dibutoxy-2-methylpentane-2,4-diol?
The canonical SMILES for 1,1-dibutoxy-2-methylpentane-2,4-diol is CCCCOC(OCCCC)C(C)(O)CC(C)O.
What is the InChIKey of 1,1-dibutoxy-2-methylpentane-2,4-diol?
The InChIKey is WQRDRXRSKWWVEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O4/c1-5-7-9-17-13(18-10-8-6-2)14(4,16)11-12(3)15/h12-13,15-16H,5-11H2,1-4H3.
What are the key properties of 1,1-dibutoxy-2-methylpentane-2,4-diol?
1,1-dibutoxy-2-methylpentane-2,4-diol has a molecular weight of 262.39 g/mol, XLogP of 2.47, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dibutoxy-2-methylpentane-2,4-diol is sourced from PubChem (CID 91844562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).