About disodium;4-hydroxy-8H-quinolin-2-one
disodium;4-hydroxy-8H-quinolin-2-one (PubChem CID 91844575) has the molecular formula C9H7NNa2O2+2
and a molecular weight of 207.14 g/mol. Its IUPAC name is disodium;4-hydroxy-8H-quinolin-2-one.
Molecular Properties
| Compound Name | disodium;4-hydroxy-8H-quinolin-2-one |
| PubChem CID | 91844575 |
| Molecular Formula | C9H7NNa2O2+2 |
| Molecular Weight | 207.14 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | disodium;4-hydroxy-8H-quinolin-2-one |
| SMILES | O=C1C=C(O)C2=CC=CCC2=N1.[Na+].[Na+] |
| InChI | InChI=1S/C9H7NO2.2Na/c11-8-5-9(12)10-7-4-2-1-3-6(7)8;;/h1-3,5,11H,4H2;;/q;2*+1 |
| InChIKey | AUUQBQMVAVSKDB-UHFFFAOYSA-N |
| XLogP | -4.70 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.14 |
| LogP ≤ 5 | -4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze disodium;4-hydroxy-8H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;4-hydroxy-8H-quinolin-2-one?
The IUPAC name of disodium;4-hydroxy-8H-quinolin-2-one (CID 91844575) is disodium;4-hydroxy-8H-quinolin-2-one.
What is the SMILES notation for disodium;4-hydroxy-8H-quinolin-2-one?
The canonical SMILES for disodium;4-hydroxy-8H-quinolin-2-one is O=C1C=C(O)C2=CC=CCC2=N1.[Na+].[Na+].
What is the InChIKey of disodium;4-hydroxy-8H-quinolin-2-one?
The InChIKey is AUUQBQMVAVSKDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2.2Na/c11-8-5-9(12)10-7-4-2-1-3-6(7)8;;/h1-3,5,11H,4H2;;/q;2*+1.
What are the key properties of disodium;4-hydroxy-8H-quinolin-2-one?
disodium;4-hydroxy-8H-quinolin-2-one has a molecular weight of 207.14 g/mol, XLogP of -4.70, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;4-hydroxy-8H-quinolin-2-one is sourced from PubChem (CID 91844575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).