About (4S)-8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride
(4S)-8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride (PubChem CID 91844824) has the molecular formula C9H11BrClNO
and a molecular weight of 264.55 g/mol. Its IUPAC name is (4S)-8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride.
Molecular Properties
| Compound Name | (4S)-8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| PubChem CID | 91844824 |
| Molecular Formula | C9H11BrClNO |
| Molecular Weight | 264.55 g/mol |
| Exact Mass | 262.97 |
| IUPAC Name | (4S)-8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| SMILES | Cl.N[C@H]1CCOc2c(Br)cccc21 |
| InChI | InChI=1S/C9H10BrNO.ClH/c10-7-3-1-2-6-8(11)4-5-12-9(6)7;/h1-3,8H,4-5,11H2;1H/t8-;/m0./s1 |
| InChIKey | GQVQWQSPIBHZSG-QRPNPIFTSA-N |
| XLogP | 2.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.55 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride?
The IUPAC name of (4S)-8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CID 91844824) is (4S)-8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride.
What is the SMILES notation for (4S)-8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride?
The canonical SMILES for (4S)-8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride is Cl.N[C@H]1CCOc2c(Br)cccc21.
What is the InChIKey of (4S)-8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride?
The InChIKey is GQVQWQSPIBHZSG-QRPNPIFTSA-N. The full InChI is InChI=1S/C9H10BrNO.ClH/c10-7-3-1-2-6-8(11)4-5-12-9(6)7;/h1-3,8H,4-5,11H2;1H/t8-;/m0./s1.
What are the key properties of (4S)-8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride?
(4S)-8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride has a molecular weight of 264.55 g/mol, XLogP of 2.65, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride is sourced from PubChem (CID 91844824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).