About CID 91844908
CID 91844908 (PubChem CID 91844908) has the molecular formula C36H44FeP2
and a molecular weight of 594.54 g/mol.
Molecular Properties
| Compound Name | CID 91844908 |
| PubChem CID | 91844908 |
| Molecular Formula | C36H44FeP2 |
| Molecular Weight | 594.54 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | — |
| SMILES | CC([C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1)P(C1CCCCC1)C1CCCCC1.[CH]1[CH][CH][CH][CH]1.[Fe] |
| InChI | InChI=1S/C31H39P2.C5H5.Fe/c1-25(32(26-15-6-2-7-16-26)27-17-8-3-9-18-27)30-23-14-24-31(30)33(28-19-10-4-11-20-28)29-21-12-5-13-22-29;1-2-4-5-3-1;/h4-5,10-14,19-27H,2-3,6-9,15-18H2,1H3;1-5H; |
| InChIKey | HGTBZFMPHBAUCQ-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 594.54 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 91844908 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91844908?
The IUPAC name of CID 91844908 (CID 91844908) is not available.
What is the SMILES notation for CID 91844908?
The canonical SMILES for CID 91844908 is CC([C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1)P(C1CCCCC1)C1CCCCC1.[CH]1[CH][CH][CH][CH]1.[Fe].
What is the InChIKey of CID 91844908?
The InChIKey is HGTBZFMPHBAUCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H39P2.C5H5.Fe/c1-25(32(26-15-6-2-7-16-26)27-17-8-3-9-18-27)30-23-14-24-31(30)33(28-19-10-4-11-20-28)29-21-12-5-13-22-29;1-2-4-5-3-1;/h4-5,10-14,19-27H,2-3,6-9,15-18H2,1H3;1-5H;.
What are the key properties of CID 91844908?
CID 91844908 has a molecular weight of 594.54 g/mol, XLogP of 9.41, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91844908 is sourced from PubChem (CID 91844908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).