About 4-(2,2-dioxooxathiazinan-4-yl)butyl 4-methylbenzenesulfonate
4-(2,2-dioxooxathiazinan-4-yl)butyl 4-methylbenzenesulfonate (PubChem CID 91844924) has the molecular formula C14H21NO6S2
and a molecular weight of 363.46 g/mol. Its IUPAC name is 4-(2,2-dioxooxathiazinan-4-yl)butyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 4-(2,2-dioxooxathiazinan-4-yl)butyl 4-methylbenzenesulfonate |
| PubChem CID | 91844924 |
| Molecular Formula | C14H21NO6S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 4-(2,2-dioxooxathiazinan-4-yl)butyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCC2CCOS(=O)(=O)N2)cc1 |
| InChI | InChI=1S/C14H21NO6S2/c1-12-5-7-14(8-6-12)22(16,17)20-10-3-2-4-13-9-11-21-23(18,19)15-13/h5-8,13,15H,2-4,9-11H2,1H3 |
| InChIKey | LUFZFWSGCOJJDM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-dioxooxathiazinan-4-yl)butyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dioxooxathiazinan-4-yl)butyl 4-methylbenzenesulfonate?
The IUPAC name of 4-(2,2-dioxooxathiazinan-4-yl)butyl 4-methylbenzenesulfonate (CID 91844924) is 4-(2,2-dioxooxathiazinan-4-yl)butyl 4-methylbenzenesulfonate.
What is the SMILES notation for 4-(2,2-dioxooxathiazinan-4-yl)butyl 4-methylbenzenesulfonate?
The canonical SMILES for 4-(2,2-dioxooxathiazinan-4-yl)butyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCCCCC2CCOS(=O)(=O)N2)cc1.
What is the InChIKey of 4-(2,2-dioxooxathiazinan-4-yl)butyl 4-methylbenzenesulfonate?
The InChIKey is LUFZFWSGCOJJDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO6S2/c1-12-5-7-14(8-6-12)22(16,17)20-10-3-2-4-13-9-11-21-23(18,19)15-13/h5-8,13,15H,2-4,9-11H2,1H3.
What are the key properties of 4-(2,2-dioxooxathiazinan-4-yl)butyl 4-methylbenzenesulfonate?
4-(2,2-dioxooxathiazinan-4-yl)butyl 4-methylbenzenesulfonate has a molecular weight of 363.46 g/mol, XLogP of 1.49, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dioxooxathiazinan-4-yl)butyl 4-methylbenzenesulfonate is sourced from PubChem (CID 91844924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).