C12H22O7 — CID 91848517
(2R,3S,4R,6R)-6-[(2R,3R,4R,6S)-3,6-dihydroxy-2-methyloxan-4-yl]oxy-2-methyloxane-3,4-diol (PubChem CID 91848517) has the molecular formula C12H22O7 and a molecular weight of 278.30 g/mol. Its IUPAC name is (2R,3S,4R,6R)-6-[(2R,3R,4R,6S)-3,6-dihydroxy-2-methyloxan-4-yl]oxy-2-methyloxane-3,4-diol.
| Compound Name | (2R,3S,4R,6R)-6-[(2R,3R,4R,6S)-3,6-dihydroxy-2-methyloxan-4-yl]oxy-2-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 91848517 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (2R,3S,4R,6R)-6-[(2R,3R,4R,6S)-3,6-dihydroxy-2-methyloxan-4-yl]oxy-2-methyloxane-3,4-diol |
| SMILES | C[C@H]1O[C@H](O)C[C@@H](O[C@@H]2C[C@@H](O)[C@H](O)[C@@H](C)O2)[C@@H]1O |
| InChI | InChI=1S/C12H22O7/c1-5-11(15)7(13)3-10(18-5)19-8-4-9(14)17-6(2)12(8)16/h5-16H,3-4H2,1-2H3/t5-,6-,7-,8-,9+,10-,11-,12-/m1/s1 |
| InChIKey | UYPSAXYOZNLOAC-RGXJTGTOSA-N |
| XLogP | -1.28 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |