C12H21FO9 — CID 91853101
(2S,3S,4R,5S,6S)-2-[(2R,3R,4S,5R,6S)-6-(fluoromethyl)-2,4,5-trihydroxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol (PubChem CID 91853101) has the molecular formula C12H21FO9 and a molecular weight of 328.29 g/mol. Its IUPAC name is (2S,3S,4R,5S,6S)-2-[(2R,3R,4S,5R,6S)-6-(fluoromethyl)-2,4,5-trihydroxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5S,6S)-2-[(2R,3R,4S,5R,6S)-6-(fluoromethyl)-2,4,5-trihydroxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 91853101 |
| Molecular Formula | C12H21FO9 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (2S,3S,4R,5S,6S)-2-[(2R,3R,4S,5R,6S)-6-(fluoromethyl)-2,4,5-trihydroxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
| SMILES | C[C@@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@@H](O)[C@@H](CF)O[C@H]2O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H21FO9/c1-3-5(14)7(16)9(18)12(20-3)22-10-8(17)6(15)4(2-13)21-11(10)19/h3-12,14-19H,2H2,1H3/t3-,4+,5+,6-,7+,8-,9-,10+,11+,12-/m0/s1 |
| InChIKey | SLXHXSSNHQJVJB-URMRTOKHSA-N |
| XLogP | -3.39 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |