C18H18ClN3O3S — CID 9185717
(3Z)-5-chloro-3-[[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylidene]-1H-indol-2-one (PubChem CID 9185717) has the molecular formula C18H18ClN3O3S and a molecular weight of 391.88 g/mol. Its IUPAC name is (3Z)-5-chloro-3-[[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-5-chloro-3-[[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 9185717 |
| Molecular Formula | C18H18ClN3O3S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | (3Z)-5-chloro-3-[[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]methylidene]-1H-indol-2-one |
| SMILES | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1/C=C1\C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H18ClN3O3S/c1-10-14(11(2)22(21-10)13-5-6-26(24,25)9-13)8-16-15-7-12(19)3-4-17(15)20-18(16)23/h3-4,7-8,13H,5-6,9H2,1-2H3,(H,20,23)/b16-8-/t13-/m0/s1 |
| InChIKey | XCBICTGVOPBXMC-TUTDSIAXSA-N |
| XLogP | 3.01 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|