C20H23N3O4S — CID 9185858
N-[3-[(E)-3-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]prop-2-enoyl]phenyl]acetamide (PubChem CID 9185858) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-[3-[(E)-3-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]prop-2-enoyl]phenyl]acetamide.
| Compound Name | N-[3-[(E)-3-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]prop-2-enoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 9185858 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-[3-[(E)-3-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]prop-2-enoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C(=O)/C=C/c2c(C)nn([C@H]3CCS(=O)(=O)C3)c2C)c1 |
| InChI | InChI=1S/C20H23N3O4S/c1-13-19(14(2)23(22-13)18-9-10-28(26,27)12-18)7-8-20(25)16-5-4-6-17(11-16)21-15(3)24/h4-8,11,18H,9-10,12H2,1-3H3,(H,21,24)/b8-7+/t18-/m0/s1 |
| InChIKey | FAVCNXLCZDIZDE-DVBCCOPCSA-N |
| XLogP | 2.71 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|