C17H18N2O3S — CID 9186065
(3R)-3-methyl-2-oxo-N-(2-phenylethyl)-1,3-dihydroindole-5-sulfonamide (PubChem CID 9186065) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is (3R)-3-methyl-2-oxo-N-(2-phenylethyl)-1,3-dihydroindole-5-sulfonamide.
| Compound Name | (3R)-3-methyl-2-oxo-N-(2-phenylethyl)-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 9186065 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (3R)-3-methyl-2-oxo-N-(2-phenylethyl)-1,3-dihydroindole-5-sulfonamide |
| SMILES | C[C@H]1C(=O)Nc2ccc(S(=O)(=O)NCCc3ccccc3)cc21 |
| InChI | InChI=1S/C17H18N2O3S/c1-12-15-11-14(7-8-16(15)19-17(12)20)23(21,22)18-10-9-13-5-3-2-4-6-13/h2-8,11-12,18H,9-10H2,1H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | WPRPPYFRBDBOOW-GFCCVEGCSA-N |
| XLogP | 2.26 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |