C15H18N2O3S — CID 9186128
(3R)-3-methyl-2-oxo-N,N-bis(prop-2-enyl)-1,3-dihydroindole-5-sulfonamide (PubChem CID 9186128) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is (3R)-3-methyl-2-oxo-N,N-bis(prop-2-enyl)-1,3-dihydroindole-5-sulfonamide.
| Compound Name | (3R)-3-methyl-2-oxo-N,N-bis(prop-2-enyl)-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 9186128 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (3R)-3-methyl-2-oxo-N,N-bis(prop-2-enyl)-1,3-dihydroindole-5-sulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc2c(c1)[C@@H](C)C(=O)N2 |
| InChI | InChI=1S/C15H18N2O3S/c1-4-8-17(9-5-2)21(19,20)12-6-7-14-13(10-12)11(3)15(18)16-14/h4-7,10-11H,1-2,8-9H2,3H3,(H,16,18)/t11-/m1/s1 |
| InChIKey | UQILHQXQBYAZDG-LLVKDONJSA-N |
| XLogP | 2.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|