About (4S,6S)-4-[1-(benzenesulfonyl)pyrrol-3-yl]-6-methyloxathiazinane 2,2-dioxide
(4S,6S)-4-[1-(benzenesulfonyl)pyrrol-3-yl]-6-methyloxathiazinane 2,2-dioxide (PubChem CID 91862973) has the molecular formula C14H16N2O5S2
and a molecular weight of 356.43 g/mol. Its IUPAC name is (4S,6S)-4-[1-(benzenesulfonyl)pyrrol-3-yl]-6-methyloxathiazinane 2,2-dioxide.
Molecular Properties
| Compound Name | (4S,6S)-4-[1-(benzenesulfonyl)pyrrol-3-yl]-6-methyloxathiazinane 2,2-dioxide |
| PubChem CID | 91862973 |
| Molecular Formula | C14H16N2O5S2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | (4S,6S)-4-[1-(benzenesulfonyl)pyrrol-3-yl]-6-methyloxathiazinane 2,2-dioxide |
| SMILES | C[C@H]1C[C@@H](c2ccn(S(=O)(=O)c3ccccc3)c2)NS(=O)(=O)O1 |
| InChI | InChI=1S/C14H16N2O5S2/c1-11-9-14(15-23(19,20)21-11)12-7-8-16(10-12)22(17,18)13-5-3-2-4-6-13/h2-8,10-11,14-15H,9H2,1H3/t11-,14-/m0/s1 |
| InChIKey | BNVXOJXDDSGZBS-FZMZJTMJSA-N |
| XLogP | 1.41 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4S,6S)-4-[1-(benzenesulfonyl)pyrrol-3-yl]-6-methyloxathiazinane 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,6S)-4-[1-(benzenesulfonyl)pyrrol-3-yl]-6-methyloxathiazinane 2,2-dioxide?
The IUPAC name of (4S,6S)-4-[1-(benzenesulfonyl)pyrrol-3-yl]-6-methyloxathiazinane 2,2-dioxide (CID 91862973) is (4S,6S)-4-[1-(benzenesulfonyl)pyrrol-3-yl]-6-methyloxathiazinane 2,2-dioxide.
What is the SMILES notation for (4S,6S)-4-[1-(benzenesulfonyl)pyrrol-3-yl]-6-methyloxathiazinane 2,2-dioxide?
The canonical SMILES for (4S,6S)-4-[1-(benzenesulfonyl)pyrrol-3-yl]-6-methyloxathiazinane 2,2-dioxide is C[C@H]1C[C@@H](c2ccn(S(=O)(=O)c3ccccc3)c2)NS(=O)(=O)O1.
What is the InChIKey of (4S,6S)-4-[1-(benzenesulfonyl)pyrrol-3-yl]-6-methyloxathiazinane 2,2-dioxide?
The InChIKey is BNVXOJXDDSGZBS-FZMZJTMJSA-N. The full InChI is InChI=1S/C14H16N2O5S2/c1-11-9-14(15-23(19,20)21-11)12-7-8-16(10-12)22(17,18)13-5-3-2-4-6-13/h2-8,10-11,14-15H,9H2,1H3/t11-,14-/m0/s1.
What are the key properties of (4S,6S)-4-[1-(benzenesulfonyl)pyrrol-3-yl]-6-methyloxathiazinane 2,2-dioxide?
(4S,6S)-4-[1-(benzenesulfonyl)pyrrol-3-yl]-6-methyloxathiazinane 2,2-dioxide has a molecular weight of 356.43 g/mol, XLogP of 1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,6S)-4-[1-(benzenesulfonyl)pyrrol-3-yl]-6-methyloxathiazinane 2,2-dioxide is sourced from PubChem (CID 91862973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).