About 2-bromo-4,5-dimethoxy-N-methylbenzenesulfonamide
2-bromo-4,5-dimethoxy-N-methylbenzenesulfonamide (PubChem CID 9186307) has the molecular formula C9H12BrNO4S
and a molecular weight of 310.17 g/mol. Its IUPAC name is 2-bromo-4,5-dimethoxy-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2-bromo-4,5-dimethoxy-N-methylbenzenesulfonamide |
| PubChem CID | 9186307 |
| Molecular Formula | C9H12BrNO4S |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | 2-bromo-4,5-dimethoxy-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C9H12BrNO4S/c1-11-16(12,13)9-5-8(15-3)7(14-2)4-6(9)10/h4-5,11H,1-3H3 |
| InChIKey | DDLOQCYMDABSIK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-bromo-4,5-dimethoxy-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4,5-dimethoxy-N-methylbenzenesulfonamide?
The IUPAC name of 2-bromo-4,5-dimethoxy-N-methylbenzenesulfonamide (CID 9186307) is 2-bromo-4,5-dimethoxy-N-methylbenzenesulfonamide.
What is the SMILES notation for 2-bromo-4,5-dimethoxy-N-methylbenzenesulfonamide?
The canonical SMILES for 2-bromo-4,5-dimethoxy-N-methylbenzenesulfonamide is CNS(=O)(=O)c1cc(OC)c(OC)cc1Br.
What is the InChIKey of 2-bromo-4,5-dimethoxy-N-methylbenzenesulfonamide?
The InChIKey is DDLOQCYMDABSIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrNO4S/c1-11-16(12,13)9-5-8(15-3)7(14-2)4-6(9)10/h4-5,11H,1-3H3.
What are the key properties of 2-bromo-4,5-dimethoxy-N-methylbenzenesulfonamide?
2-bromo-4,5-dimethoxy-N-methylbenzenesulfonamide has a molecular weight of 310.17 g/mol, XLogP of 1.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4,5-dimethoxy-N-methylbenzenesulfonamide is sourced from PubChem (CID 9186307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).