C46H88N4O2 — CID 91864481
N-[3-(dimethylamino)propyl]-10-[2-[8-[3-(dimethylamino)propylamino]-8-oxooctyl]-5,6-dihexylcyclohex-3-en-1-yl]dec-9-enamide (PubChem CID 91864481) has the molecular formula C46H88N4O2 and a molecular weight of 729.24 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-10-[2-[8-[3-(dimethylamino)propylamino]-8-oxooctyl]-5,6-dihexylcyclohex-3-en-1-yl]dec-9-enamide.
| Compound Name | N-[3-(dimethylamino)propyl]-10-[2-[8-[3-(dimethylamino)propylamino]-8-oxooctyl]-5,6-dihexylcyclohex-3-en-1-yl]dec-9-enamide |
|---|---|
| PubChem CID | 91864481 |
| Molecular Formula | C46H88N4O2 |
| Molecular Weight | 729.24 g/mol |
| Exact Mass | 728.69 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-10-[2-[8-[3-(dimethylamino)propylamino]-8-oxooctyl]-5,6-dihexylcyclohex-3-en-1-yl]dec-9-enamide |
| SMILES | CCCCCCC1C=CC(CCCCCCCC(=O)NCCCN(C)C)C(C=CCCCCCCCC(=O)NCCCN(C)C)C1CCCCCC |
| InChI | InChI=1S/C46H88N4O2/c1-7-9-11-21-29-41-35-36-42(30-22-17-16-20-26-34-46(52)48-38-28-40-50(5)6)44(43(41)31-23-12-10-8-2)32-24-18-14-13-15-19-25-33-45(51)47-37-27-39-49(3)4/h24,32,35-36,41-44H,7-23,25-31,33-34,37-40H2,1-6H3,(H,47,51)(H,48,52) |
| InChIKey | MFUARKCVEHMGDO-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.24 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|