C32H54Si — CID 91865122
[(1R)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-[(1S)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-cyclohexyl-octylsilane (PubChem CID 91865122) has the molecular formula C32H54Si and a molecular weight of 466.87 g/mol. Its IUPAC name is [(1R)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-[(1S)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-cyclohexyl-octylsilane.
| Compound Name | [(1R)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-[(1S)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-cyclohexyl-octylsilane |
|---|---|
| PubChem CID | 91865122 |
| Molecular Formula | C32H54Si |
| Molecular Weight | 466.87 g/mol |
| Exact Mass | 466.40 |
| IUPAC Name | [(1R)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-[(1S)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-cyclohexyl-octylsilane |
| SMILES | CCCCCCCC[Si@](C1CCCCC1)([C@@H]1CCC2CCCCC21)[C@H]1CCC2C=CC=CC21 |
| InChI | InChI=1S/C32H54Si/c1-2-3-4-5-6-14-25-33(28-17-8-7-9-18-28,31-23-21-26-15-10-12-19-29(26)31)32-24-22-27-16-11-13-20-30(27)32/h10,12,15,19,26-32H,2-9,11,13-14,16-18,20-25H2,1H3/t26?,27?,29?,30?,31-,32+,33+/m0/s1 |
| InChIKey | BWJOSDTXOTVHOK-NEPSMZHTSA-N |
| XLogP | 10.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.87 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|