C12H24FIOSi — CID 91865186
tert-butyl-[(1S,2R,4R)-2-fluoro-4-(iodomethyl)cyclopentyl]oxy-dimethylsilane (PubChem CID 91865186) has the molecular formula C12H24FIOSi and a molecular weight of 358.31 g/mol. Its IUPAC name is tert-butyl-[(1S,2R,4R)-2-fluoro-4-(iodomethyl)cyclopentyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2R,4R)-2-fluoro-4-(iodomethyl)cyclopentyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 91865186 |
| Molecular Formula | C12H24FIOSi |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | tert-butyl-[(1S,2R,4R)-2-fluoro-4-(iodomethyl)cyclopentyl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H](CI)C[C@H]1F |
| InChI | InChI=1S/C12H24FIOSi/c1-12(2,3)16(4,5)15-11-7-9(8-14)6-10(11)13/h9-11H,6-8H2,1-5H3/t9-,10+,11-/m0/s1 |
| InChIKey | UJJIZGQILVQZLO-AXFHLTTASA-N |
| XLogP | 4.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|