C36H27IrN2O2S- — CID 91866100
iridium;9-phenyl-7-(2,4,6-trimethylphenyl)-4H-phenanthro[9,10-d][1,3]thiazol-4-ide;pyridine-2-carboxylic acid (PubChem CID 91866100) has the molecular formula C36H27IrN2O2S- and a molecular weight of 743.91 g/mol. Its IUPAC name is iridium;9-phenyl-7-(2,4,6-trimethylphenyl)-4H-phenanthro[9,10-d][1,3]thiazol-4-ide;pyridine-2-carboxylic acid.
| Compound Name | iridium;9-phenyl-7-(2,4,6-trimethylphenyl)-4H-phenanthro[9,10-d][1,3]thiazol-4-ide;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 91866100 |
| Molecular Formula | C36H27IrN2O2S- |
| Molecular Weight | 743.91 g/mol |
| Exact Mass | 744.14 |
| IUPAC Name | iridium;9-phenyl-7-(2,4,6-trimethylphenyl)-4H-phenanthro[9,10-d][1,3]thiazol-4-ide;pyridine-2-carboxylic acid |
| SMILES | Cc1cc(C)c(-c2cc[c-]c3c4ncsc4c4ccc(-c5ccccc5)cc4c23)c(C)c1.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C30H22NS.C6H5NO2.Ir/c1-18-14-19(2)27(20(3)15-18)24-10-7-11-25-28(24)26-16-22(21-8-5-4-6-9-21)12-13-23(26)30-29(25)31-17-32-30;8-6(9)5-3-1-2-4-7-5;/h4-10,12-17H,1-3H3;1-4H,(H,8,9);/q-1;; |
| InChIKey | PHBHUOUSYHYIPR-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.91 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|