About N-but-1-en-2-ylmethanimine;tungsten(2+);yttrium
N-but-1-en-2-ylmethanimine;tungsten(2+);yttrium (PubChem CID 91866514) has the molecular formula C5H7NWY
and a molecular weight of 353.86 g/mol. Its IUPAC name is N-but-1-en-2-ylmethanimine;tungsten(2+);yttrium.
Molecular Properties
| Compound Name | N-but-1-en-2-ylmethanimine;tungsten(2+);yttrium |
| PubChem CID | 91866514 |
| Molecular Formula | C5H7NWY |
| Molecular Weight | 353.86 g/mol |
| Exact Mass | 353.91 |
| IUPAC Name | N-but-1-en-2-ylmethanimine;tungsten(2+);yttrium |
| SMILES | [H]/[C-]=N/C(=C)[CH-]C.[W+2].[Y] |
| InChI | InChI=1S/C5H7N.W.Y/c1-4-5(2)6-3;;/h3-4H,2H2,1H3;;/q-2;+2; |
| InChIKey | JROZRQJGEQJJKK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.86 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-but-1-en-2-ylmethanimine;tungsten(2+);yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-1-en-2-ylmethanimine;tungsten(2+);yttrium?
The IUPAC name of N-but-1-en-2-ylmethanimine;tungsten(2+);yttrium (CID 91866514) is N-but-1-en-2-ylmethanimine;tungsten(2+);yttrium.
What is the SMILES notation for N-but-1-en-2-ylmethanimine;tungsten(2+);yttrium?
The canonical SMILES for N-but-1-en-2-ylmethanimine;tungsten(2+);yttrium is [H]/[C-]=N/C(=C)[CH-]C.[W+2].[Y].
What is the InChIKey of N-but-1-en-2-ylmethanimine;tungsten(2+);yttrium?
The InChIKey is JROZRQJGEQJJKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N.W.Y/c1-4-5(2)6-3;;/h3-4H,2H2,1H3;;/q-2;+2;.
What are the key properties of N-but-1-en-2-ylmethanimine;tungsten(2+);yttrium?
N-but-1-en-2-ylmethanimine;tungsten(2+);yttrium has a molecular weight of 353.86 g/mol, XLogP of 1.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-1-en-2-ylmethanimine;tungsten(2+);yttrium is sourced from PubChem (CID 91866514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).