C63H110BN3O15Si2 — CID 91866931
CID 91866931 (PubChem CID 91866931) has the molecular formula C63H110BN3O15Si2 and a molecular weight of 1216.56 g/mol.
| Compound Name | CID 91866931 |
|---|---|
| PubChem CID | 91866931 |
| Molecular Formula | C63H110BN3O15Si2 |
| Molecular Weight | 1216.56 g/mol |
| Exact Mass | 1215.76 |
| IUPAC Name | — |
| SMILES | [B]C(=O)NCCCCCCNC(=O)OCCC1/C=C(\C)C[C@H](C)C[C@H](OC)[C@H]2O[C@@](O)(C(=O)C(=O)N3CCCC[C@H]3C(=O)O[C@H](/C(C)=C/[C@@H]3CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC)C3)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)CC1=O)[C@H](C)C[C@@H]2OC |
| InChI | InChI=1S/C63H110BN3O15Si2/c1-40-33-41(2)35-52(76-13)55-53(77-14)37-43(4)63(74,80-55)56(69)57(70)67-31-24-21-25-47(67)58(71)79-54(42(3)36-45-26-27-49(51(38-45)75-12)81-83(15,16)61(6,7)8)44(5)50(82-84(17,18)62(9,10)11)39-48(68)46(34-40)28-32-78-60(73)66-30-23-20-19-22-29-65-59(64)72/h34,36,41,43-47,49-55,74H,19-33,35,37-39H2,1-18H3,(H,65,72)(H,66,73)/b40-34+,42-36+/t41-,43+,44+,45-,46?,47-,49+,50-,51+,52-,53-,54+,55+,63+/m0/s1 |
| InChIKey | PBPUVCCIOFKQAL-KZJYCRSISA-N |
| XLogP | 10.68 |
| TPSA | 223.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1216.56 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|