C22H23N3O18 — CID 91867174
[(2S,5R)-3,5-bis[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy]-4-hydroxy-6-methoxyoxan-2-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 91867174) has the molecular formula C22H23N3O18 and a molecular weight of 617.43 g/mol. Its IUPAC name is [(2S,5R)-3,5-bis[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy]-4-hydroxy-6-methoxyoxan-2-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | [(2S,5R)-3,5-bis[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy]-4-hydroxy-6-methoxyoxan-2-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 91867174 |
| Molecular Formula | C22H23N3O18 |
| Molecular Weight | 617.43 g/mol |
| Exact Mass | 617.10 |
| IUPAC Name | [(2S,5R)-3,5-bis[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy]-4-hydroxy-6-methoxyoxan-2-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | COC1O[C@@H](COC(=O)ON2C(=O)CCC2=O)C(OC(=O)ON2C(=O)CCC2=O)C(O)[C@H]1OC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C22H23N3O18/c1-36-19-18(40-22(35)43-25-14(30)6-7-15(25)31)16(32)17(39-21(34)42-24-12(28)4-5-13(24)29)9(38-19)8-37-20(33)41-23-10(26)2-3-11(23)27/h9,16-19,32H,2-8H2,1H3/t9-,16?,17?,18+,19?/m0/s1 |
| InChIKey | MVKDBQWGKCEQFX-JUZWHFPGSA-N |
| XLogP | -1.89 |
| TPSA | 257.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.43 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|