C13H24BNO3 — CID 91867957
[(3R,3aS,6aR)-3-[(2-methylpropan-2-yl)oxycarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-methylborinic acid (PubChem CID 91867957) has the molecular formula C13H24BNO3 and a molecular weight of 253.15 g/mol. Its IUPAC name is [(3R,3aS,6aR)-3-[(2-methylpropan-2-yl)oxycarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-methylborinic acid.
| Compound Name | [(3R,3aS,6aR)-3-[(2-methylpropan-2-yl)oxycarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-methylborinic acid |
|---|---|
| PubChem CID | 91867957 |
| Molecular Formula | C13H24BNO3 |
| Molecular Weight | 253.15 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | [(3R,3aS,6aR)-3-[(2-methylpropan-2-yl)oxycarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-methylborinic acid |
| SMILES | CB(O)N1C[C@@H]2CCC[C@@H]2[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H24BNO3/c1-13(2,3)18-12(16)11-10-7-5-6-9(10)8-15(11)14(4)17/h9-11,17H,5-8H2,1-4H3/t9-,10-,11+/m0/s1 |
| InChIKey | PMGKLDQJSOIVJB-GARJFASQSA-N |
| XLogP | 1.54 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.15 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|