C32H55O9PSi — CID 91868136
[(1S,3S,7S,8S,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-diethoxyphosphorylbutanoate (PubChem CID 91868136) has the molecular formula C32H55O9PSi and a molecular weight of 642.84 g/mol. Its IUPAC name is [(1S,3S,7S,8S,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-diethoxyphosphorylbutanoate.
| Compound Name | [(1S,3S,7S,8S,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-diethoxyphosphorylbutanoate |
|---|---|
| PubChem CID | 91868136 |
| Molecular Formula | C32H55O9PSi |
| Molecular Weight | 642.84 g/mol |
| Exact Mass | 642.34 |
| IUPAC Name | [(1S,3S,7S,8S,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-diethoxyphosphorylbutanoate |
| SMILES | CCOP(=O)(OCC)[C@@H](CC)C(=O)O[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C32H55O9PSi/c1-10-28(42(36,37-11-2)38-12-3)31(35)40-27-20-25(41-43(8,9)32(5,6)7)17-22-14-13-21(4)26(30(22)27)16-15-24-18-23(33)19-29(34)39-24/h13-14,17,21,23-28,30,33H,10-12,15-16,18-20H2,1-9H3/t21-,23+,24+,25+,26-,27-,28-,30-/m0/s1 |
| InChIKey | UVZZGGFQDJUIKQ-JZNPAJEFSA-N |
| XLogP | 6.95 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.84 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|