About N,2-dimethanidyl-3-(methoxymethyl)but-3-en-2-amine;tungsten(2+);yttrium
N,2-dimethanidyl-3-(methoxymethyl)but-3-en-2-amine;tungsten(2+);yttrium (PubChem CID 91868213) has the molecular formula C8H15NOWY
and a molecular weight of 413.96 g/mol. Its IUPAC name is N,2-dimethanidyl-3-(methoxymethyl)but-3-en-2-amine;tungsten(2+);yttrium.
Molecular Properties
| Compound Name | N,2-dimethanidyl-3-(methoxymethyl)but-3-en-2-amine;tungsten(2+);yttrium |
| PubChem CID | 91868213 |
| Molecular Formula | C8H15NOWY |
| Molecular Weight | 413.96 g/mol |
| Exact Mass | 413.97 |
| IUPAC Name | N,2-dimethanidyl-3-(methoxymethyl)but-3-en-2-amine;tungsten(2+);yttrium |
| SMILES | C=C(COC)C([CH2-])(C)N[CH2-].[W+2].[Y] |
| InChI | InChI=1S/C8H15NO.W.Y/c1-7(6-10-5)8(2,3)9-4;;/h9H,1-2,4,6H2,3,5H3;;/q-2;+2; |
| InChIKey | MYGDUBANCWVSDJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.96 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,2-dimethanidyl-3-(methoxymethyl)but-3-en-2-amine;tungsten(2+);yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethanidyl-3-(methoxymethyl)but-3-en-2-amine;tungsten(2+);yttrium?
The IUPAC name of N,2-dimethanidyl-3-(methoxymethyl)but-3-en-2-amine;tungsten(2+);yttrium (CID 91868213) is N,2-dimethanidyl-3-(methoxymethyl)but-3-en-2-amine;tungsten(2+);yttrium.
What is the SMILES notation for N,2-dimethanidyl-3-(methoxymethyl)but-3-en-2-amine;tungsten(2+);yttrium?
The canonical SMILES for N,2-dimethanidyl-3-(methoxymethyl)but-3-en-2-amine;tungsten(2+);yttrium is C=C(COC)C([CH2-])(C)N[CH2-].[W+2].[Y].
What is the InChIKey of N,2-dimethanidyl-3-(methoxymethyl)but-3-en-2-amine;tungsten(2+);yttrium?
The InChIKey is MYGDUBANCWVSDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.W.Y/c1-7(6-10-5)8(2,3)9-4;;/h9H,1-2,4,6H2,3,5H3;;/q-2;+2;.
What are the key properties of N,2-dimethanidyl-3-(methoxymethyl)but-3-en-2-amine;tungsten(2+);yttrium?
N,2-dimethanidyl-3-(methoxymethyl)but-3-en-2-amine;tungsten(2+);yttrium has a molecular weight of 413.96 g/mol, XLogP of 1.16, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethanidyl-3-(methoxymethyl)but-3-en-2-amine;tungsten(2+);yttrium is sourced from PubChem (CID 91868213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).