C15H13N — CID 91868291
(5E,7Z,9Z,11Z,13E)-cyclododeca[b]pyridine (PubChem CID 91868291) has the molecular formula C15H13N and a molecular weight of 207.28 g/mol. Its IUPAC name is (5E,7Z,9Z,11Z,13E)-cyclododeca[b]pyridine.
| Compound Name | (5E,7Z,9Z,11Z,13E)-cyclododeca[b]pyridine |
|---|---|
| PubChem CID | 91868291 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | (5E,7Z,9Z,11Z,13E)-cyclododeca[b]pyridine |
| SMILES | C1=C\C=C/C=C\c2ncccc2/C=C\C=C/1 |
| InChI | InChI=1S/C15H13N/c1-2-4-6-8-12-15-14(10-7-5-3-1)11-9-13-16-15/h1-13H/b2-1-,3-1-,4-2-,5-3-,6-4-,7-5-,8-6-,10-7-,12-8-,14-10-,15-12+ |
| InChIKey | RFVCKUHJWBNJHS-TVJDSUOKSA-N |
| XLogP | 3.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |