C20H40O10Si8 — CID 91868373
2,4,6,8-tetramethyl-2-[[4-[(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)methoxy]naphthalen-1-yl]oxymethyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 91868373) has the molecular formula C20H40O10Si8 and a molecular weight of 665.22 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-2-[[4-[(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)methoxy]naphthalen-1-yl]oxymethyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetramethyl-2-[[4-[(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)methoxy]naphthalen-1-yl]oxymethyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 91868373 |
| Molecular Formula | C20H40O10Si8 |
| Molecular Weight | 665.22 g/mol |
| Exact Mass | 664.08 |
| IUPAC Name | 2,4,6,8-tetramethyl-2-[[4-[(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)methoxy]naphthalen-1-yl]oxymethyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[SiH]1O[SiH](C)O[Si](C)(COc2ccc(OC[Si]3(C)O[SiH](C)O[SiH](C)O[SiH](C)O3)c3ccccc23)O[SiH](C)O1 |
| InChI | InChI=1S/C20H40O10Si8/c1-31-23-33(3)27-37(7,28-34(4)24-31)15-21-19-13-14-20(18-12-10-9-11-17(18)19)22-16-38(8)29-35(5)25-32(2)26-36(6)30-38/h9-14,31-36H,15-16H2,1-8H3 |
| InChIKey | ATVQIYIJEJLZSO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|