About bis(dioxido(oxo)silane);germanium(4+)
bis(dioxido(oxo)silane);germanium(4+) (PubChem CID 91868461) has the molecular formula GeO6Si2
and a molecular weight of 224.78 g/mol. Its IUPAC name is bis(dioxido(oxo)silane);germanium(4+).
Molecular Properties
| Compound Name | bis(dioxido(oxo)silane);germanium(4+) |
| PubChem CID | 91868461 |
| Molecular Formula | GeO6Si2 |
| Molecular Weight | 224.78 g/mol |
| Exact Mass | 225.84 |
| IUPAC Name | bis(dioxido(oxo)silane);germanium(4+) |
| SMILES | O=[Si]([O-])[O-].O=[Si]([O-])[O-].[Ge+4] |
| InChI | InChI=1S/Ge.2O3Si/c;2*1-4(2)3/q+4;2*-2 |
| InChIKey | WQIGDFSCLWXEIL-UHFFFAOYSA-N |
| XLogP | -6.14 |
| TPSA | 126.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.78 |
| LogP ≤ 5 | -6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(dioxido(oxo)silane);germanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dioxido(oxo)silane);germanium(4+)?
The IUPAC name of bis(dioxido(oxo)silane);germanium(4+) (CID 91868461) is bis(dioxido(oxo)silane);germanium(4+).
What is the SMILES notation for bis(dioxido(oxo)silane);germanium(4+)?
The canonical SMILES for bis(dioxido(oxo)silane);germanium(4+) is O=[Si]([O-])[O-].O=[Si]([O-])[O-].[Ge+4].
What is the InChIKey of bis(dioxido(oxo)silane);germanium(4+)?
The InChIKey is WQIGDFSCLWXEIL-UHFFFAOYSA-N. The full InChI is InChI=1S/Ge.2O3Si/c;2*1-4(2)3/q+4;2*-2.
What are the key properties of bis(dioxido(oxo)silane);germanium(4+)?
bis(dioxido(oxo)silane);germanium(4+) has a molecular weight of 224.78 g/mol, XLogP of -6.14, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dioxido(oxo)silane);germanium(4+) is sourced from PubChem (CID 91868461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).