About CID 91868785
CID 91868785 (PubChem CID 91868785) has the molecular formula C41H35BiS2
and a molecular weight of 800.85 g/mol.
Molecular Properties
| Compound Name | CID 91868785 |
| PubChem CID | 91868785 |
| Molecular Formula | C41H35BiS2 |
| Molecular Weight | 800.85 g/mol |
| Exact Mass | 800.20 |
| IUPAC Name | — |
| SMILES | Cc1cccc(-c2cccc(-c3cccc(C)c3)c2SC([Bi])Sc2c(-c3cccc(C)c3)cccc2-c2cccc(C)c2)c1 |
| InChI | InChI=1S/C41H35S2.Bi/c1-28-11-5-15-32(23-28)36-19-9-20-37(33-16-6-12-29(2)24-33)40(36)42-27-43-41-38(34-17-7-13-30(3)25-34)21-10-22-39(41)35-18-8-14-31(4)26-35;/h5-27H,1-4H3; |
| InChIKey | UTXQKODTRZVJPN-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 800.85 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 91868785 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91868785?
The IUPAC name of CID 91868785 (CID 91868785) is not available.
What is the SMILES notation for CID 91868785?
The canonical SMILES for CID 91868785 is Cc1cccc(-c2cccc(-c3cccc(C)c3)c2SC([Bi])Sc2c(-c3cccc(C)c3)cccc2-c2cccc(C)c2)c1.
What is the InChIKey of CID 91868785?
The InChIKey is UTXQKODTRZVJPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C41H35S2.Bi/c1-28-11-5-15-32(23-28)36-19-9-20-37(33-16-6-12-29(2)24-33)40(36)42-27-43-41-38(34-17-7-13-30(3)25-34)21-10-22-39(41)35-18-8-14-31(4)26-35;/h5-27H,1-4H3;.
What are the key properties of CID 91868785?
CID 91868785 has a molecular weight of 800.85 g/mol, XLogP of 11.92, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91868785 is sourced from PubChem (CID 91868785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).