About naphtho[2,3-e][1]benzothiole
naphtho[2,3-e][1]benzothiole (PubChem CID 9187) has the molecular formula C16H10S
and a molecular weight of 234.32 g/mol. Its IUPAC name is naphtho[2,3-e][1]benzothiole.
Molecular Properties
| Compound Name | naphtho[2,3-e][1]benzothiole |
| PubChem CID | 9187 |
| Molecular Formula | C16H10S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | naphtho[2,3-e][1]benzothiole |
| SMILES | c1ccc2cc3c(ccc4sccc43)cc2c1 |
| InChI | InChI=1S/C16H10S/c1-2-4-12-10-15-13(9-11(12)3-1)5-6-16-14(15)7-8-17-16/h1-10H |
| InChIKey | PAYSBLPSJQBEJR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze naphtho[2,3-e][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphtho[2,3-e][1]benzothiole?
The IUPAC name of naphtho[2,3-e][1]benzothiole (CID 9187) is naphtho[2,3-e][1]benzothiole.
What is the SMILES notation for naphtho[2,3-e][1]benzothiole?
The canonical SMILES for naphtho[2,3-e][1]benzothiole is c1ccc2cc3c(ccc4sccc43)cc2c1.
What is the InChIKey of naphtho[2,3-e][1]benzothiole?
The InChIKey is PAYSBLPSJQBEJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10S/c1-2-4-12-10-15-13(9-11(12)3-1)5-6-16-14(15)7-8-17-16/h1-10H.
What are the key properties of naphtho[2,3-e][1]benzothiole?
naphtho[2,3-e][1]benzothiole has a molecular weight of 234.32 g/mol, XLogP of 5.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for naphtho[2,3-e][1]benzothiole is sourced from PubChem (CID 9187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).