C15H16N2 — CID 91870113
(2E,4E,6E)-N-methyl-2-[(E)-prop-1-enyl]-1-benzazocin-3-amine (PubChem CID 91870113) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is (2E,4E,6E)-N-methyl-2-[(E)-prop-1-enyl]-1-benzazocin-3-amine.
| Compound Name | (2E,4E,6E)-N-methyl-2-[(E)-prop-1-enyl]-1-benzazocin-3-amine |
|---|---|
| PubChem CID | 91870113 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (2E,4E,6E)-N-methyl-2-[(E)-prop-1-enyl]-1-benzazocin-3-amine |
| SMILES | C/C=C/C1=C(NC)/C=C\C=c2\cccc/c2=N/1 |
| InChI | InChI=1S/C15H16N2/c1-3-7-15-14(16-2)11-6-9-12-8-4-5-10-13(12)17-15/h3-11,16H,1-2H3/b7-3+,9-6-,11-6-,12-9-,14-11+,15-14+,17-13-,17-15- |
| InChIKey | IVSYGSFWVBDXEF-NWMRWBEZSA-N |
| XLogP | 1.66 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |