C14H17N — CID 91870301
(6Z,8Z,10Z)-2,3,4,4a,5,11b-hexahydro-1H-cycloocta[b]indole (PubChem CID 91870301) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is (6Z,8Z,10Z)-2,3,4,4a,5,11b-hexahydro-1H-cycloocta[b]indole.
| Compound Name | (6Z,8Z,10Z)-2,3,4,4a,5,11b-hexahydro-1H-cycloocta[b]indole |
|---|---|
| PubChem CID | 91870301 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (6Z,8Z,10Z)-2,3,4,4a,5,11b-hexahydro-1H-cycloocta[b]indole |
| SMILES | C1=C\C=C/C2=C(\C=C/1)NC1CCCCC21 |
| InChI | InChI=1S/C14H17N/c1-2-4-9-13-11(7-3-1)12-8-5-6-10-14(12)15-13/h1-4,7,9,12,14-15H,5-6,8,10H2/b2-1-,3-1-,4-2-,7-3-,9-4-,11-7-,13-9+ |
| InChIKey | VUOVNKNJZCUABT-JTKGGIRCSA-N |
| XLogP | 3.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |