C14H10N2O — CID 91870440
(4aZ,10aZ,12E)-1H-pyrido[3,2-c][1]benzazocin-2-one (PubChem CID 91870440) has the molecular formula C14H10N2O and a molecular weight of 222.25 g/mol. Its IUPAC name is (4aZ,10aZ,12E)-1H-pyrido[3,2-c][1]benzazocin-2-one.
| Compound Name | (4aZ,10aZ,12E)-1H-pyrido[3,2-c][1]benzazocin-2-one |
|---|---|
| PubChem CID | 91870440 |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | (4aZ,10aZ,12E)-1H-pyrido[3,2-c][1]benzazocin-2-one |
| SMILES | O=c1ccc2/c([nH]1)=C\C=c1\cccc\c1=N\C=2 |
| InChI | InChI=1S/C14H10N2O/c17-14-8-6-11-9-15-12-4-2-1-3-10(12)5-7-13(11)16-14/h1-9H,(H,16,17)/b7-5-,10-5-,11-9-,13-7+,15-9-,15-12- |
| InChIKey | URMVKYSRCBRORY-KCBSLMQGSA-N |
| XLogP | -0.99 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |