C17H36O2 — CID 91870578
5-ethyl-4,5,7-trimethyl-4-propylnonane-1,7-diol (PubChem CID 91870578) has the molecular formula C17H36O2 and a molecular weight of 272.47 g/mol. Its IUPAC name is 5-ethyl-4,5,7-trimethyl-4-propylnonane-1,7-diol.
| Compound Name | 5-ethyl-4,5,7-trimethyl-4-propylnonane-1,7-diol |
|---|---|
| PubChem CID | 91870578 |
| Molecular Formula | C17H36O2 |
| Molecular Weight | 272.47 g/mol |
| Exact Mass | 272.27 |
| IUPAC Name | 5-ethyl-4,5,7-trimethyl-4-propylnonane-1,7-diol |
| SMILES | CCCC(C)(CCCO)C(C)(CC)CC(C)(O)CC |
| InChI | InChI=1S/C17H36O2/c1-7-11-16(5,12-10-13-18)15(4,8-2)14-17(6,19)9-3/h18-19H,7-14H2,1-6H3 |
| InChIKey | XVJUHRHXKQJMHH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |