About 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]ethyl N-cyanocarbamodithioate
2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]ethyl N-cyanocarbamodithioate (PubChem CID 91871285) has the molecular formula C11H8ClN3S4
and a molecular weight of 345.93 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]ethyl N-cyanocarbamodithioate.
Molecular Properties
| Compound Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]ethyl N-cyanocarbamodithioate |
| PubChem CID | 91871285 |
| Molecular Formula | C11H8ClN3S4 |
| Molecular Weight | 345.93 g/mol |
| Exact Mass | 344.93 |
| IUPAC Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]ethyl N-cyanocarbamodithioate |
| SMILES | N#CNC(=S)SCCSc1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C11H8ClN3S4/c12-7-1-2-9-8(5-7)15-11(19-9)18-4-3-17-10(16)14-6-13/h1-2,5H,3-4H2,(H,14,16) |
| InChIKey | QMSMLICMXCANFI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.93 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]ethyl N-cyanocarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]ethyl N-cyanocarbamodithioate?
The IUPAC name of 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]ethyl N-cyanocarbamodithioate (CID 91871285) is 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]ethyl N-cyanocarbamodithioate.
What is the SMILES notation for 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]ethyl N-cyanocarbamodithioate?
The canonical SMILES for 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]ethyl N-cyanocarbamodithioate is N#CNC(=S)SCCSc1nc2cc(Cl)ccc2s1.
What is the InChIKey of 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]ethyl N-cyanocarbamodithioate?
The InChIKey is QMSMLICMXCANFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClN3S4/c12-7-1-2-9-8(5-7)15-11(19-9)18-4-3-17-10(16)14-6-13/h1-2,5H,3-4H2,(H,14,16).
What are the key properties of 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]ethyl N-cyanocarbamodithioate?
2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]ethyl N-cyanocarbamodithioate has a molecular weight of 345.93 g/mol, XLogP of 4.13, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]ethyl N-cyanocarbamodithioate is sourced from PubChem (CID 91871285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).