C16H16O5 — CID 91872178
(E)-3-(4-methoxyphenyl)-1-(2,4,6-trihydroxycyclohexa-2,4-dien-1-yl)prop-2-en-1-one (PubChem CID 91872178) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-1-(2,4,6-trihydroxycyclohexa-2,4-dien-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-methoxyphenyl)-1-(2,4,6-trihydroxycyclohexa-2,4-dien-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 91872178 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-1-(2,4,6-trihydroxycyclohexa-2,4-dien-1-yl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)C2C(O)=CC(O)=CC2O)cc1 |
| InChI | InChI=1S/C16H16O5/c1-21-12-5-2-10(3-6-12)4-7-13(18)16-14(19)8-11(17)9-15(16)20/h2-9,14,16-17,19-20H,1H3/b7-4+ |
| InChIKey | BVVLTBJMYJGSPQ-QPJJXVBHSA-N |
| XLogP | 2.15 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|