C17H13Cl2FN2O2 — CID 9187304
2-(1,2-benzoxazol-3-yl)-N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]acetamide (PubChem CID 9187304) has the molecular formula C17H13Cl2FN2O2 and a molecular weight of 367.21 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)-N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-(1,2-benzoxazol-3-yl)-N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 9187304 |
| Molecular Formula | C17H13Cl2FN2O2 |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)-N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]acetamide |
| SMILES | C[C@@H](NC(=O)Cc1noc2ccccc12)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H13Cl2FN2O2/c1-9(11-6-14(20)13(19)7-12(11)18)21-17(23)8-15-10-4-2-3-5-16(10)24-22-15/h2-7,9H,8H2,1H3,(H,21,23)/t9-/m1/s1 |
| InChIKey | BJDJZZSSADZEIV-SECBINFHSA-N |
| XLogP | 4.69 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|