C20H17FN4O — CID 9187312
(E)-3-[5-(2-fluorophenyl)furan-2-yl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile (PubChem CID 9187312) has the molecular formula C20H17FN4O and a molecular weight of 348.38 g/mol. Its IUPAC name is (E)-3-[5-(2-fluorophenyl)furan-2-yl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[5-(2-fluorophenyl)furan-2-yl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9187312 |
| Molecular Formula | C20H17FN4O |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (E)-3-[5-(2-fluorophenyl)furan-2-yl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2ccccc2F)o1)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C20H17FN4O/c21-17-7-4-3-6-16(17)18-10-9-15(26-18)12-14(13-22)20-24-23-19-8-2-1-5-11-25(19)20/h3-4,6-7,9-10,12H,1-2,5,8,11H2/b14-12+ |
| InChIKey | CDLILAXRAIRKDQ-WYMLVPIESA-N |
| XLogP | 4.47 |
| TPSA | 67.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|