azane;(sulfoamino)sulfamic acid

H10N4O6S2 — CID 91873124

IUPACazane;(sulfoamino)sulfamic acid
SMILESN.N.O=S(=O)(O)NNS(=O)(=O)O
InChIInChI=1S/H4N2O6S2.2H3N/c3-9(4,5)1-2-10(6,7)8;;/h1-2H,(H,3,4,5)(H,6,7,8);2*1H3
InChIKeyLVLNKGKSELZCKK-UHFFFAOYSA-N
MW226.24 g/mol
LogP-1.99
Rot. Bonds3

About azane;(sulfoamino)sulfamic acid

azane;(sulfoamino)sulfamic acid (PubChem CID 91873124) has the molecular formula H10N4O6S2 and a molecular weight of 226.24 g/mol. Its IUPAC name is azane;(sulfoamino)sulfamic acid.

Molecular Properties

Compound Nameazane;(sulfoamino)sulfamic acid
PubChem CID91873124
Molecular FormulaH10N4O6S2
Molecular Weight226.24 g/mol
Exact Mass226.00
IUPAC Nameazane;(sulfoamino)sulfamic acid
SMILESN.N.O=S(=O)(O)NNS(=O)(=O)O
InChIInChI=1S/H4N2O6S2.2H3N/c3-9(4,5)1-2-10(6,7)8;;/h1-2H,(H,3,4,5)(H,6,7,8);2*1H3
InChIKeyLVLNKGKSELZCKK-UHFFFAOYSA-N
XLogP-1.99
TPSA202.80 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500226.24
LogP ≤ 5-1.99
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze azane;(sulfoamino)sulfamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;(sulfoamino)sulfamic acid?
The IUPAC name of azane;(sulfoamino)sulfamic acid (CID 91873124) is azane;(sulfoamino)sulfamic acid.
What is the SMILES notation for azane;(sulfoamino)sulfamic acid?
The canonical SMILES for azane;(sulfoamino)sulfamic acid is N.N.O=S(=O)(O)NNS(=O)(=O)O.
What is the InChIKey of azane;(sulfoamino)sulfamic acid?
The InChIKey is LVLNKGKSELZCKK-UHFFFAOYSA-N. The full InChI is InChI=1S/H4N2O6S2.2H3N/c3-9(4,5)1-2-10(6,7)8;;/h1-2H,(H,3,4,5)(H,6,7,8);2*1H3.
What are the key properties of azane;(sulfoamino)sulfamic acid?
azane;(sulfoamino)sulfamic acid has a molecular weight of 226.24 g/mol, XLogP of -1.99, 3 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(sulfoamino)sulfamic acid is sourced from PubChem (CID 91873124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).