About methanesulfonic acid;methyl (1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate
methanesulfonic acid;methyl (1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate (PubChem CID 91873527) has the molecular formula C11H19NO5S
and a molecular weight of 277.34 g/mol. Its IUPAC name is methanesulfonic acid;methyl (1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate.
Molecular Properties
| Compound Name | methanesulfonic acid;methyl (1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate |
| PubChem CID | 91873527 |
| Molecular Formula | C11H19NO5S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | methanesulfonic acid;methyl (1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate |
| SMILES | COC(=O)C1=CC[C@H]2CC[C@H]1N2C.CS(=O)(=O)O |
| InChI | InChI=1S/C10H15NO2.CH4O3S/c1-11-7-3-5-8(10(12)13-2)9(11)6-4-7;1-5(2,3)4/h5,7,9H,3-4,6H2,1-2H3;1H3,(H,2,3,4)/t7-,9+;/m0./s1 |
| InChIKey | YGKWXYGEZHGALW-DKXTVVGFSA-N |
| XLogP | 0.46 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonic acid;methyl (1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonic acid;methyl (1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate?
The IUPAC name of methanesulfonic acid;methyl (1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate (CID 91873527) is methanesulfonic acid;methyl (1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate.
What is the SMILES notation for methanesulfonic acid;methyl (1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate?
The canonical SMILES for methanesulfonic acid;methyl (1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate is COC(=O)C1=CC[C@H]2CC[C@H]1N2C.CS(=O)(=O)O.
What is the InChIKey of methanesulfonic acid;methyl (1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate?
The InChIKey is YGKWXYGEZHGALW-DKXTVVGFSA-N. The full InChI is InChI=1S/C10H15NO2.CH4O3S/c1-11-7-3-5-8(10(12)13-2)9(11)6-4-7;1-5(2,3)4/h5,7,9H,3-4,6H2,1-2H3;1H3,(H,2,3,4)/t7-,9+;/m0./s1.
What are the key properties of methanesulfonic acid;methyl (1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate?
methanesulfonic acid;methyl (1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate has a molecular weight of 277.34 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonic acid;methyl (1R,5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate is sourced from PubChem (CID 91873527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).