C20H16NO4 — CID 91873603
CID 91873603 (PubChem CID 91873603) has the molecular formula C20H16NO4 and a molecular weight of 334.35 g/mol.
| Compound Name | CID 91873603 |
|---|---|
| PubChem CID | 91873603 |
| Molecular Formula | C20H16NO4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | — |
| SMILES | CCOc1ccccc1NC(=O)c1c([C]=O)c(O)cc2ccccc12 |
| InChI | InChI=1S/C20H16NO4/c1-2-25-18-10-6-5-9-16(18)21-20(24)19-14-8-4-3-7-13(14)11-17(23)15(19)12-22/h3-11,23H,2H2,1H3,(H,21,24) |
| InChIKey | JFYHYDOLJMNHQY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |