C28H44ClNO2 — CID 91873688
benzyl-dimethyl-[2-[2-(2-methyl-4-octylphenoxy)ethoxy]ethyl]azanium chloride (PubChem CID 91873688) has the molecular formula C28H44ClNO2 and a molecular weight of 462.12 g/mol. Its IUPAC name is benzyl-dimethyl-[2-[2-(2-methyl-4-octylphenoxy)ethoxy]ethyl]azanium chloride.
| Compound Name | benzyl-dimethyl-[2-[2-(2-methyl-4-octylphenoxy)ethoxy]ethyl]azanium chloride |
|---|---|
| PubChem CID | 91873688 |
| Molecular Formula | C28H44ClNO2 |
| Molecular Weight | 462.12 g/mol |
| Exact Mass | 461.31 |
| IUPAC Name | benzyl-dimethyl-[2-[2-(2-methyl-4-octylphenoxy)ethoxy]ethyl]azanium chloride |
| SMILES | CCCCCCCCc1ccc(OCCOCC[N+](C)(C)Cc2ccccc2)c(C)c1.[Cl-] |
| InChI | InChI=1S/C28H44NO2.ClH/c1-5-6-7-8-9-11-14-26-17-18-28(25(2)23-26)31-22-21-30-20-19-29(3,4)24-27-15-12-10-13-16-27;/h10,12-13,15-18,23H,5-9,11,14,19-22,24H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | OMLGQDFBDGHEAB-UHFFFAOYSA-M |
| XLogP | 3.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.12 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|