C20H30O5 — CID 91873697
(Z)-2-hydroxy-7-[(1R,2R,3R)-3-hydroxy-2-[(1E,5Z)-octa-1,5-dienyl]-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 91873697) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (Z)-2-hydroxy-7-[(1R,2R,3R)-3-hydroxy-2-[(1E,5Z)-octa-1,5-dienyl]-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-2-hydroxy-7-[(1R,2R,3R)-3-hydroxy-2-[(1E,5Z)-octa-1,5-dienyl]-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91873697 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (Z)-2-hydroxy-7-[(1R,2R,3R)-3-hydroxy-2-[(1E,5Z)-octa-1,5-dienyl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CC/C=C\CC/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCC(O)C(=O)O |
| InChI | InChI=1S/C20H30O5/c1-2-3-4-5-6-8-11-15-16(19(23)14-18(15)22)12-9-7-10-13-17(21)20(24)25/h3-4,7-9,11,15-18,21-22H,2,5-6,10,12-14H2,1H3,(H,24,25)/b4-3-,9-7-,11-8+/t15-,16-,17?,18-/m1/s1 |
| InChIKey | AIHVFAVNHWOMMX-XXDRVQENSA-N |
| XLogP | 3.03 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|