About 7-amino-5-hydroxy-1,3-benzoxathiol-2-one
7-amino-5-hydroxy-1,3-benzoxathiol-2-one (PubChem CID 91875333) has the molecular formula C7H5NO3S
and a molecular weight of 183.19 g/mol. Its IUPAC name is 7-amino-5-hydroxy-1,3-benzoxathiol-2-one.
Molecular Properties
| Compound Name | 7-amino-5-hydroxy-1,3-benzoxathiol-2-one |
| PubChem CID | 91875333 |
| Molecular Formula | C7H5NO3S |
| Molecular Weight | 183.19 g/mol |
| Exact Mass | 183.00 |
| IUPAC Name | 7-amino-5-hydroxy-1,3-benzoxathiol-2-one |
| SMILES | Nc1cc(O)cc2sc(=O)oc12 |
| InChI | InChI=1S/C7H5NO3S/c8-4-1-3(9)2-5-6(4)11-7(10)12-5/h1-2,9H,8H2 |
| InChIKey | NTXFZSOMNRHWQA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-5-hydroxy-1,3-benzoxathiol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-5-hydroxy-1,3-benzoxathiol-2-one?
The IUPAC name of 7-amino-5-hydroxy-1,3-benzoxathiol-2-one (CID 91875333) is 7-amino-5-hydroxy-1,3-benzoxathiol-2-one.
What is the SMILES notation for 7-amino-5-hydroxy-1,3-benzoxathiol-2-one?
The canonical SMILES for 7-amino-5-hydroxy-1,3-benzoxathiol-2-one is Nc1cc(O)cc2sc(=O)oc12.
What is the InChIKey of 7-amino-5-hydroxy-1,3-benzoxathiol-2-one?
The InChIKey is NTXFZSOMNRHWQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3S/c8-4-1-3(9)2-5-6(4)11-7(10)12-5/h1-2,9H,8H2.
What are the key properties of 7-amino-5-hydroxy-1,3-benzoxathiol-2-one?
7-amino-5-hydroxy-1,3-benzoxathiol-2-one has a molecular weight of 183.19 g/mol, XLogP of 1.14, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-5-hydroxy-1,3-benzoxathiol-2-one is sourced from PubChem (CID 91875333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).