C11H8BrNO4S2 — CID 91875370
2-[(5-bromo-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid (PubChem CID 91875370) has the molecular formula C11H8BrNO4S2 and a molecular weight of 362.23 g/mol. Its IUPAC name is 2-[(5-bromo-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid.
| Compound Name | 2-[(5-bromo-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid |
|---|---|
| PubChem CID | 91875370 |
| Molecular Formula | C11H8BrNO4S2 |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 360.91 |
| IUPAC Name | 2-[(5-bromo-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid |
| SMILES | O=C(O)CC(Sc1nc2cc(Br)ccc2s1)C(=O)O |
| InChI | InChI=1S/C11H8BrNO4S2/c12-5-1-2-7-6(3-5)13-11(18-7)19-8(10(16)17)4-9(14)15/h1-3,8H,4H2,(H,14,15)(H,16,17) |
| InChIKey | PVPWWVLHPYTCNU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |