About 2-(2-iodophenyl)sulfanyl-1,3,5-trimethylbenzene
2-(2-iodophenyl)sulfanyl-1,3,5-trimethylbenzene (PubChem CID 91875706) has the molecular formula C15H15IS
and a molecular weight of 354.26 g/mol. Its IUPAC name is 2-(2-iodophenyl)sulfanyl-1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | 2-(2-iodophenyl)sulfanyl-1,3,5-trimethylbenzene |
| PubChem CID | 91875706 |
| Molecular Formula | C15H15IS |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | 2-(2-iodophenyl)sulfanyl-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(Sc2ccccc2I)c(C)c1 |
| InChI | InChI=1S/C15H15IS/c1-10-8-11(2)15(12(3)9-10)17-14-7-5-4-6-13(14)16/h4-9H,1-3H3 |
| InChIKey | QDBJZSWFTUQIOJ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-iodophenyl)sulfanyl-1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-iodophenyl)sulfanyl-1,3,5-trimethylbenzene?
The IUPAC name of 2-(2-iodophenyl)sulfanyl-1,3,5-trimethylbenzene (CID 91875706) is 2-(2-iodophenyl)sulfanyl-1,3,5-trimethylbenzene.
What is the SMILES notation for 2-(2-iodophenyl)sulfanyl-1,3,5-trimethylbenzene?
The canonical SMILES for 2-(2-iodophenyl)sulfanyl-1,3,5-trimethylbenzene is Cc1cc(C)c(Sc2ccccc2I)c(C)c1.
What is the InChIKey of 2-(2-iodophenyl)sulfanyl-1,3,5-trimethylbenzene?
The InChIKey is QDBJZSWFTUQIOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15IS/c1-10-8-11(2)15(12(3)9-10)17-14-7-5-4-6-13(14)16/h4-9H,1-3H3.
What are the key properties of 2-(2-iodophenyl)sulfanyl-1,3,5-trimethylbenzene?
2-(2-iodophenyl)sulfanyl-1,3,5-trimethylbenzene has a molecular weight of 354.26 g/mol, XLogP of 5.37, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-iodophenyl)sulfanyl-1,3,5-trimethylbenzene is sourced from PubChem (CID 91875706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).