C12H7Cl2NO2S — CID 91876619
2,4-dichloro-1-(4-nitrophenyl)sulfanylbenzene (PubChem CID 91876619) has the molecular formula C12H7Cl2NO2S and a molecular weight of 300.17 g/mol. Its IUPAC name is 2,4-dichloro-1-(4-nitrophenyl)sulfanylbenzene.
| Compound Name | 2,4-dichloro-1-(4-nitrophenyl)sulfanylbenzene |
|---|---|
| PubChem CID | 91876619 |
| Molecular Formula | C12H7Cl2NO2S |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 298.96 |
| IUPAC Name | 2,4-dichloro-1-(4-nitrophenyl)sulfanylbenzene |
| SMILES | O=[N+]([O-])c1ccc(Sc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C12H7Cl2NO2S/c13-8-1-6-12(11(14)7-8)18-10-4-2-9(3-5-10)15(16)17/h1-7H |
| InChIKey | ZQDVIVZXGICHGE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|