C14H12Br2S — CID 91877723
1,2-dibromo-4-(4-ethylphenyl)sulfanylbenzene (PubChem CID 91877723) has the molecular formula C14H12Br2S and a molecular weight of 372.13 g/mol. Its IUPAC name is 1,2-dibromo-4-(4-ethylphenyl)sulfanylbenzene.
| Compound Name | 1,2-dibromo-4-(4-ethylphenyl)sulfanylbenzene |
|---|---|
| PubChem CID | 91877723 |
| Molecular Formula | C14H12Br2S |
| Molecular Weight | 372.13 g/mol |
| Exact Mass | 369.90 |
| IUPAC Name | 1,2-dibromo-4-(4-ethylphenyl)sulfanylbenzene |
| SMILES | CCc1ccc(Sc2ccc(Br)c(Br)c2)cc1 |
| InChI | InChI=1S/C14H12Br2S/c1-2-10-3-5-11(6-4-10)17-12-7-8-13(15)14(16)9-12/h3-9H,2H2,1H3 |
| InChIKey | HMIURUSPOSYIRR-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.13 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |