C15H10F3NO4S — CID 91879161
2-[4-(4-nitrophenyl)sulfanyl-3-(trifluoromethyl)phenyl]acetic acid (PubChem CID 91879161) has the molecular formula C15H10F3NO4S and a molecular weight of 357.31 g/mol. Its IUPAC name is 2-[4-(4-nitrophenyl)sulfanyl-3-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-[4-(4-nitrophenyl)sulfanyl-3-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 91879161 |
| Molecular Formula | C15H10F3NO4S |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 2-[4-(4-nitrophenyl)sulfanyl-3-(trifluoromethyl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(Sc2ccc([N+](=O)[O-])cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H10F3NO4S/c16-15(17,18)12-7-9(8-14(20)21)1-6-13(12)24-11-4-2-10(3-5-11)19(22)23/h1-7H,8H2,(H,20,21) |
| InChIKey | YAZPIMPTCLYPGY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|