C19H22N2O — CID 9188107
(3Z)-3-[(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)methylidene]-1-methylindol-2-one (PubChem CID 9188107) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (3Z)-3-[(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)methylidene]-1-methylindol-2-one.
| Compound Name | (3Z)-3-[(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)methylidene]-1-methylindol-2-one |
|---|---|
| PubChem CID | 9188107 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (3Z)-3-[(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)methylidene]-1-methylindol-2-one |
| SMILES | Cc1cc(/C=C2\C(=O)N(C)c3ccccc32)c(C)n1C(C)C |
| InChI | InChI=1S/C19H22N2O/c1-12(2)21-13(3)10-15(14(21)4)11-17-16-8-6-7-9-18(16)20(5)19(17)22/h6-12H,1-5H3/b17-11- |
| InChIKey | OCENGZOFKULLJB-BOPFTXTBSA-N |
| XLogP | 4.20 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|