C8H8Cl2S — CID 91881184
1,4-dichloro-2-methyl-3-methylsulfanylbenzene (PubChem CID 91881184) has the molecular formula C8H8Cl2S and a molecular weight of 207.12 g/mol. Its IUPAC name is 1,4-dichloro-2-methyl-3-methylsulfanylbenzene.
| Compound Name | 1,4-dichloro-2-methyl-3-methylsulfanylbenzene |
|---|---|
| PubChem CID | 91881184 |
| Molecular Formula | C8H8Cl2S |
| Molecular Weight | 207.12 g/mol |
| Exact Mass | 205.97 |
| IUPAC Name | 1,4-dichloro-2-methyl-3-methylsulfanylbenzene |
| SMILES | CSc1c(Cl)ccc(Cl)c1C |
| InChI | InChI=1S/C8H8Cl2S/c1-5-6(9)3-4-7(10)8(5)11-2/h3-4H,1-2H3 |
| InChIKey | FVGVNNNBGGUNEF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.12 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |